Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Gold wire, 2.0mm (0.08in) dia, 99.95% (metals basis)
CAS: 7440-57-5 Molecular Formula: Au Molecular Weight (g/mol): 196.97 MDL Number: MFCD00003436 InChI Key: PCHJSUWPFVWCPO-UHFFFAOYSA-N Synonym: colloidal,powder,flake,leaf,gold, colloidal,burnish,shell,ci pigment metal 3,magnesium purple,c.i. pigment metal 3 PubChem CID: 23985 ChEBI: CHEBI:30050 IUPAC Name: gold SMILES: [Au]
| PubChem CID | 23985 |
|---|---|
| CAS | 7440-57-5 |
| Molecular Weight (g/mol) | 196.97 |
| ChEBI | CHEBI:30050 |
| MDL Number | MFCD00003436 |
| SMILES | [Au] |
| Synonym | colloidal,powder,flake,leaf,gold, colloidal,burnish,shell,ci pigment metal 3,magnesium purple,c.i. pigment metal 3 |
| IUPAC Name | gold |
| InChI Key | PCHJSUWPFVWCPO-UHFFFAOYSA-N |
| Molecular Formula | Au |
1,1,3,3,5,5-Hexamethyltrisiloxane, 95%
CAS: 1189-93-1 Molecular Formula: C6H18O2Si3 Molecular Weight (g/mol): 206.463 MDL Number: MFCD00039788 InChI Key: YTEISYFNYGDBRV-UHFFFAOYSA-N Synonym: 1,1,3,3,5,5-hexamethyltrisiloxane,trisiloxane, 1,1,3,3,5,5-hexamethyl,1,3,3,5,5-hexamethyltrisiloxane,2,4,4,6-tetramethyl-3,5-dioxa-2,4,6-trisilaheptane,dimethylbis dimethylsilyloxy silane PubChem CID: 6327152 IUPAC Name: [(dimethyl-$l^{3}-silanyl)oxy-dimethylsilyl]oxy-dimethylsilicon SMILES: C[Si](C)O[Si](C)(C)O[Si](C)C
| PubChem CID | 6327152 |
|---|---|
| CAS | 1189-93-1 |
| Molecular Weight (g/mol) | 206.463 |
| MDL Number | MFCD00039788 |
| SMILES | C[Si](C)O[Si](C)(C)O[Si](C)C |
| Synonym | 1,1,3,3,5,5-hexamethyltrisiloxane,trisiloxane, 1,1,3,3,5,5-hexamethyl,1,3,3,5,5-hexamethyltrisiloxane,2,4,4,6-tetramethyl-3,5-dioxa-2,4,6-trisilaheptane,dimethylbis dimethylsilyloxy silane |
| IUPAC Name | [(dimethyl-$l^{3}-silanyl)oxy-dimethylsilyl]oxy-dimethylsilicon |
| InChI Key | YTEISYFNYGDBRV-UHFFFAOYSA-N |
| Molecular Formula | C6H18O2Si3 |
Lithium iodide hydrate, 99%, extra pure
CAS: 85017-80-7 Molecular Formula: ILi Molecular Weight (g/mol): 133.84 MDL Number: MFCD00149769 InChI Key: HSZCZNFXUDYRKD-UHFFFAOYSA-M Synonym: lithium iodide hydrate,lithium iodide monohydrate,ilio,lii.h2o,lithium iodide mono hydrate,lithium iodide hydrate, puratronic,lithium 1+ ion hydrate iodide,lithium iodide lii ,monohydrate 9ci PubChem CID: 23688290 SMILES: [Li+].[I-]
| PubChem CID | 23688290 |
|---|---|
| CAS | 85017-80-7 |
| Molecular Weight (g/mol) | 133.84 |
| MDL Number | MFCD00149769 |
| SMILES | [Li+].[I-] |
| Synonym | lithium iodide hydrate,lithium iodide monohydrate,ilio,lii.h2o,lithium iodide mono hydrate,lithium iodide hydrate, puratronic,lithium 1+ ion hydrate iodide,lithium iodide lii ,monohydrate 9ci |
| InChI Key | HSZCZNFXUDYRKD-UHFFFAOYSA-M |
| Molecular Formula | ILi |
Bismuth citrate, 94%
CAS: 813-93-4 Molecular Formula: C6H5BiO7 Molecular Weight (g/mol): 398.079 MDL Number: MFCD00050817 InChI Key: ANERHPOLUMFRDC-UHFFFAOYSA-K Synonym: bismuth citrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, bismuth 3+ salt 1:1,bismuth citrate usp:usp,bismuth iii citrate,bismuth citrate usp,bismuth 3+ ion citrate,bismuth, citrato 3-,bismuth iii citrate 250g,bismuth 2-hydroxypropane-1,2,3-tricarboxylate PubChem CID: 13135 IUPAC Name: bismuth;2-hydroxypropane-1,2,3-tricarboxylate SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.[Bi+3]
| PubChem CID | 13135 |
|---|---|
| CAS | 813-93-4 |
| Molecular Weight (g/mol) | 398.079 |
| MDL Number | MFCD00050817 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.[Bi+3] |
| Synonym | bismuth citrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, bismuth 3+ salt 1:1,bismuth citrate usp:usp,bismuth iii citrate,bismuth citrate usp,bismuth 3+ ion citrate,bismuth, citrato 3-,bismuth iii citrate 250g,bismuth 2-hydroxypropane-1,2,3-tricarboxylate |
| IUPAC Name | bismuth;2-hydroxypropane-1,2,3-tricarboxylate |
| InChI Key | ANERHPOLUMFRDC-UHFFFAOYSA-K |
| Molecular Formula | C6H5BiO7 |
Sodium nitrate, 99+%, for analysis, Thermo Scientific Chemicals
CAS: 7631-99-4 Molecular Formula: NNaO3 Molecular Weight (g/mol): 84.99 MDL Number: MFCD00011119 InChI Key: VWDWKYIASSYTQR-UHFFFAOYSA-N Synonym: sodium nitrate,chile saltpeter,nitrate of soda,cubic niter,etabisulfite,nitratine,soda niter,sodium saltpeter,nitric acid, sodium salt,sodium i nitrate 1:1 PubChem CID: 24268 ChEBI: CHEBI:63005 SMILES: [Na+].[O-][N+]([O-])=O
| PubChem CID | 24268 |
|---|---|
| CAS | 7631-99-4 |
| Molecular Weight (g/mol) | 84.99 |
| ChEBI | CHEBI:63005 |
| MDL Number | MFCD00011119 |
| SMILES | [Na+].[O-][N+]([O-])=O |
| Synonym | sodium nitrate,chile saltpeter,nitrate of soda,cubic niter,etabisulfite,nitratine,soda niter,sodium saltpeter,nitric acid, sodium salt,sodium i nitrate 1:1 |
| InChI Key | VWDWKYIASSYTQR-UHFFFAOYSA-N |
| Molecular Formula | NNaO3 |
Sodium methoxide, 0.5M solution in methanol, AcroSeal™
CAS: 124-41-4 Molecular Formula: CH3NaO Molecular Weight (g/mol): 54.02 MDL Number: MFCD00012179 InChI Key: WQDUMFSSJAZKTM-UHFFFAOYSA-N Synonym: sodium methanolate,sodium methoxide,sodium methylate,methoxysodium,methanol, sodium salt,feldalat nm,metilato sodico spanish,unii-ig663u5emc,methylate de sodium french,hsdb 755 PubChem CID: 10942334 IUPAC Name: sodium;methanolate SMILES: C[O-].[Na+]
| PubChem CID | 10942334 |
|---|---|
| CAS | 124-41-4 |
| Molecular Weight (g/mol) | 54.02 |
| MDL Number | MFCD00012179 |
| SMILES | C[O-].[Na+] |
| Synonym | sodium methanolate,sodium methoxide,sodium methylate,methoxysodium,methanol, sodium salt,feldalat nm,metilato sodico spanish,unii-ig663u5emc,methylate de sodium french,hsdb 755 |
| IUPAC Name | sodium;methanolate |
| InChI Key | WQDUMFSSJAZKTM-UHFFFAOYSA-N |
| Molecular Formula | CH3NaO |
Antimony powder, -100 mesh, 99.5% (metals basis)
CAS: 7440-36-0 Molecular Formula: Sb Molecular Weight (g/mol): 121.76 MDL Number: MFCD00011211 MFCD00134030 InChI Key: WATWJIUSRGPENY-UHFFFAOYSA-N Synonym: powder,stibium metallicum,antimony, metallic,antimony, elemental,stibanylidyne,unii-9it35j3uv3,antymonowodor polish,unii-0vkz97k3ub,0vkz97k3ub,antimonwasserstoffes german PubChem CID: 5354495 ChEBI: CHEBI:30304 IUPAC Name: antimony SMILES: [Sb]
| PubChem CID | 5354495 |
|---|---|
| CAS | 7440-36-0 |
| Molecular Weight (g/mol) | 121.76 |
| ChEBI | CHEBI:30304 |
| MDL Number | MFCD00011211 MFCD00134030 |
| SMILES | [Sb] |
| Synonym | powder,stibium metallicum,antimony, metallic,antimony, elemental,stibanylidyne,unii-9it35j3uv3,antymonowodor polish,unii-0vkz97k3ub,0vkz97k3ub,antimonwasserstoffes german |
| IUPAC Name | antimony |
| InChI Key | WATWJIUSRGPENY-UHFFFAOYSA-N |
| Molecular Formula | Sb |
Thermo Scientific Chemicals Sodium bicarbonate, 99.5%, for biochemistry
CAS: 144-55-8 Molecular Formula: CHNaO3 Molecular Weight (g/mol): 84.01 MDL Number: MFCD00003528 InChI Key: UIIMBOGNXHQVGW-UHFFFAOYSA-M Synonym: sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut PubChem CID: 516892 ChEBI: CHEBI:32139 IUPAC Name: sodium;hydrogen carbonate SMILES: [Na+].OC([O-])=O
| PubChem CID | 516892 |
|---|---|
| CAS | 144-55-8 |
| Molecular Weight (g/mol) | 84.01 |
| ChEBI | CHEBI:32139 |
| MDL Number | MFCD00003528 |
| SMILES | [Na+].OC([O-])=O |
| Synonym | sodium bicarbonate,sodium hydrogen carbonate,baking soda,carbonic acid monosodium salt,sodium acid carbonate,bicarbonate of soda,sodium hydrogencarbonate,meylon,acidosan,neut |
| IUPAC Name | sodium;hydrogen carbonate |
| InChI Key | UIIMBOGNXHQVGW-UHFFFAOYSA-M |
| Molecular Formula | CHNaO3 |
Antimony powder, -200 mesh, 99.5% (metals basis)
CAS: 7440-36-0 Molecular Formula: Sb Molecular Weight (g/mol): 121.76 MDL Number: MFCD00011211 MFCD00134030 InChI Key: WATWJIUSRGPENY-UHFFFAOYSA-N Synonym: powder,stibium metallicum,antimony, metallic,antimony, elemental,stibanylidyne,unii-9it35j3uv3,antymonowodor polish,unii-0vkz97k3ub,0vkz97k3ub,antimonwasserstoffes german PubChem CID: 5354495 ChEBI: CHEBI:30304 SMILES: [Sb]
| PubChem CID | 5354495 |
|---|---|
| CAS | 7440-36-0 |
| Molecular Weight (g/mol) | 121.76 |
| ChEBI | CHEBI:30304 |
| MDL Number | MFCD00011211 MFCD00134030 |
| SMILES | [Sb] |
| Synonym | powder,stibium metallicum,antimony, metallic,antimony, elemental,stibanylidyne,unii-9it35j3uv3,antymonowodor polish,unii-0vkz97k3ub,0vkz97k3ub,antimonwasserstoffes german |
| InChI Key | WATWJIUSRGPENY-UHFFFAOYSA-N |
| Molecular Formula | Sb |
Methylmagnesium bromide, 1M solution in CPME, AcroSeal™
CAS: 75-16-1 Molecular Formula: CH3BrMg Molecular Weight (g/mol): 119.24 MDL Number: MFCD00000041 InChI Key: AVFUHBJCUUTGCD-UHFFFAOYSA-M Synonym: methylmagnesium bromide,methyl magnesium bromide,magnesium, bromomethyl,bromo methyl magnesium,methylmagnesium bromide solution, 3.0 m in diethyl ether,unii-22cw9773df,memgbr,methymagnesiumbromide,ch3mgbr,methylmagnesiumbromide,grignard reagent PubChem CID: 6349 IUPAC Name: magnesium;carbanide;bromide SMILES: C[Mg]Br
| PubChem CID | 6349 |
|---|---|
| CAS | 75-16-1 |
| Molecular Weight (g/mol) | 119.24 |
| MDL Number | MFCD00000041 |
| SMILES | C[Mg]Br |
| Synonym | methylmagnesium bromide,methyl magnesium bromide,magnesium, bromomethyl,bromo methyl magnesium,methylmagnesium bromide solution, 3.0 m in diethyl ether,unii-22cw9773df,memgbr,methymagnesiumbromide,ch3mgbr,methylmagnesiumbromide,grignard reagent |
| IUPAC Name | magnesium;carbanide;bromide |
| InChI Key | AVFUHBJCUUTGCD-UHFFFAOYSA-M |
| Molecular Formula | CH3BrMg |
Gold wire, 0.5mm (0.02in) dia, Premion™, 99.9985% (metals basis)
CAS: 7440-57-5 Molecular Formula: Au Molecular Weight (g/mol): 196.97 MDL Number: MFCD00003436 InChI Key: PCHJSUWPFVWCPO-UHFFFAOYSA-N Synonym: colloidal,powder,flake,leaf,gold, colloidal,burnish,shell,ci pigment metal 3,magnesium purple,c.i. pigment metal 3 PubChem CID: 23985 ChEBI: CHEBI:30050 IUPAC Name: gold SMILES: [Au]
| PubChem CID | 23985 |
|---|---|
| CAS | 7440-57-5 |
| Molecular Weight (g/mol) | 196.97 |
| ChEBI | CHEBI:30050 |
| MDL Number | MFCD00003436 |
| SMILES | [Au] |
| Synonym | colloidal,powder,flake,leaf,gold, colloidal,burnish,shell,ci pigment metal 3,magnesium purple,c.i. pigment metal 3 |
| IUPAC Name | gold |
| InChI Key | PCHJSUWPFVWCPO-UHFFFAOYSA-N |
| Molecular Formula | Au |
Gold wire, 0.25mm (0.01in) dia, Premion™, 99.998% (metals basis)
CAS: 7440-57-5 Molecular Formula: Au Molecular Weight (g/mol): 196.97 MDL Number: MFCD00003436 InChI Key: PCHJSUWPFVWCPO-UHFFFAOYSA-N Synonym: colloidal,powder,flake,leaf,gold, colloidal,burnish,shell,ci pigment metal 3,magnesium purple,c.i. pigment metal 3 PubChem CID: 23985 ChEBI: CHEBI:30050 IUPAC Name: gold SMILES: [Au]
| PubChem CID | 23985 |
|---|---|
| CAS | 7440-57-5 |
| Molecular Weight (g/mol) | 196.97 |
| ChEBI | CHEBI:30050 |
| MDL Number | MFCD00003436 |
| SMILES | [Au] |
| Synonym | colloidal,powder,flake,leaf,gold, colloidal,burnish,shell,ci pigment metal 3,magnesium purple,c.i. pigment metal 3 |
| IUPAC Name | gold |
| InChI Key | PCHJSUWPFVWCPO-UHFFFAOYSA-N |
| Molecular Formula | Au |
Copper powder, -100 mesh, 99.999% (metals basis)
CAS: 7440-50-8 Molecular Formula: Cu Molecular Weight (g/mol): 63.55 MDL Number: MFCD00010965 InChI Key: RYGMFSIKBFXOCR-UHFFFAOYSA-N Synonym: cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer PubChem CID: 23978 ChEBI: CHEBI:30052 IUPAC Name: copper SMILES: [Cu]
| PubChem CID | 23978 |
|---|---|
| CAS | 7440-50-8 |
| Molecular Weight (g/mol) | 63.55 |
| ChEBI | CHEBI:30052 |
| MDL Number | MFCD00010965 |
| SMILES | [Cu] |
| Synonym | cuprum,cobre,cuivre,blister,cathode,bronze,powder,anode,precipitates,kupfer |
| IUPAC Name | copper |
| InChI Key | RYGMFSIKBFXOCR-UHFFFAOYSA-N |
| Molecular Formula | Cu |
Phosphoenolpyruvic acid tricyclohexylammonium salt
CAS: 35556-70-8 Molecular Formula: C21H44N3O6P Molecular Weight (g/mol): 465.57 MDL Number: MFCD00004258 InChI Key: MJKYGUXBFYGLLM-UHFFFAOYSA-N Synonym: phosphoenolpyruvic acid tris cyclohexylammonium salt,tris cyclohexylamine ; phosphoenolpyruvic acid,phosphoenolpyruvic acid, tris cyclohexylammonium salt,pep-3cha,phosphoenol pyruvate tri cyclohexylammonium salt,phosphoenolpyruvic acid tricyclohexylammonium salt,phosphoenolpyruvic acid tris cyclohexylamine salt,2-phosphonooxy-2-propenoic acid tri cyclohexylammonium salt,axi c 1/4 +/-ui feminineea ey>>. 1/4 masculine degrees .ni,phospho enol pyruvic acid tri cyclohexylammonium salt enzymatic PubChem CID: 11754241 IUPAC Name: 2-(phosphonooxy)prop-2-enoic acid; tris(cyclohexanamine) SMILES: NC1CCCCC1.NC1CCCCC1.NC1CCCCC1.OC(=O)C(=C)OP(O)(O)=O
| PubChem CID | 11754241 |
|---|---|
| CAS | 35556-70-8 |
| Molecular Weight (g/mol) | 465.57 |
| MDL Number | MFCD00004258 |
| SMILES | NC1CCCCC1.NC1CCCCC1.NC1CCCCC1.OC(=O)C(=C)OP(O)(O)=O |
| Synonym | phosphoenolpyruvic acid tris cyclohexylammonium salt,tris cyclohexylamine ; phosphoenolpyruvic acid,phosphoenolpyruvic acid, tris cyclohexylammonium salt,pep-3cha,phosphoenol pyruvate tri cyclohexylammonium salt,phosphoenolpyruvic acid tricyclohexylammonium salt,phosphoenolpyruvic acid tris cyclohexylamine salt,2-phosphonooxy-2-propenoic acid tri cyclohexylammonium salt,axi c 1/4 +/-ui feminineea ey>>. 1/4 masculine degrees .ni,phospho enol pyruvic acid tri cyclohexylammonium salt enzymatic |
| IUPAC Name | 2-(phosphonooxy)prop-2-enoic acid; tris(cyclohexanamine) |
| InChI Key | MJKYGUXBFYGLLM-UHFFFAOYSA-N |
| Molecular Formula | C21H44N3O6P |
Mercury(II) chloride, 98+%
CAS: 7487-94-7 Molecular Formula: Cl2Hg Molecular Weight (g/mol): 271.49 MDL Number: MFCD00011041 InChI Key: LWJROJCJINYWOX-UHFFFAOYSA-L Synonym: mercuric chloride,mercury ii chloride,sublimate,mercury bichloride,mercury dichloride,corrosive sublimate,mercuric bichloride,mercury perchloride,sublimat,hgcl2 PubChem CID: 24085 ChEBI: CHEBI:31823 IUPAC Name: dichloromercury SMILES: [Cl-].[Cl-].[Hg++]
| PubChem CID | 24085 |
|---|---|
| CAS | 7487-94-7 |
| Molecular Weight (g/mol) | 271.49 |
| ChEBI | CHEBI:31823 |
| MDL Number | MFCD00011041 |
| SMILES | [Cl-].[Cl-].[Hg++] |
| Synonym | mercuric chloride,mercury ii chloride,sublimate,mercury bichloride,mercury dichloride,corrosive sublimate,mercuric bichloride,mercury perchloride,sublimat,hgcl2 |
| IUPAC Name | dichloromercury |
| InChI Key | LWJROJCJINYWOX-UHFFFAOYSA-L |
| Molecular Formula | Cl2Hg |